(+)-Cinchonine
ALDRICH/857270 - 85%
Synonym: Cinchonine monohydrochloride dihydrate; NSC 6176
CAS Number: 118-10-5
Empirical Formula (Hill Notation): C19H22N2O
Molecular Weight: 294.39
EC Number: 204-234-6
MDL Number: MFCD00064372
Linear Formula: C19H22N2O
Product Type: Chemical
| assay | 85% |
| form | solid |
| functional group | hydroxyl |
| InChI | 1S/C19H22N2O/c1-2-13-12-2 |
| InChI key | KMPWYEUPVWOPIM-QAMTZSDWSA |
| mp | 258-260 °C (lit.) |
| optical activity | [α]23/D +228°, c = 0.5 in ethanol |
| Quality Level | 100 ![]() |
| SMILES string | [H][C@@]12CCN(C[C@H]1C=C) |
| Application: | (+)-Cinchonine, in the presence of lithium diisopropylamide (LDA) forms a complex, which can catalyze the asymmetric conjugate addition of benzyl- and alkylphosphonates to aromatic and heteroaromatic nitroalkenes to form the corresponding adducts. |
| General description: | (+)-Cinchonine, one of the alkaloids found in the barks of cinchona tree, is mainly used in the treatment of malaria. It belongs to the monoclinic crystal system and P21 space group. The solubility of cinchonine can be improved by the formation of inclusion complexes with cyclodextrins. |
| Other Notes: | remainder dihydrocinchonine |
| Packaging: | 25, 100 g in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H317 |
| Precautionary statements | P261 - P264 - P270 - P280 - P301 + P312 - P302 + P352 |
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Purity | 85% |
| mp | 258-260 °C (lit.) |
| UNSPSC | 12352104 |


