Synonym: 2,3,4,6-Tetra-O-benzyl-glucopyranose; 2,3,4,6-Tetrakis-O-(phenylmethyl)-D-glucopyranose
CAS Number: 4132-28-9
Empirical Formula (Hill Notation): C34H36O6
Molecular Weight: 540.65
MDL Number: MFCD00066004
Linear Formula: C34H36O6
Product Type: Chemical
| assay |
≥98.0% (TLC) |
| form |
solid |
| InChI |
1S/C34H36O6/c35-34-33(39-24-29-19-11-4-12-20-29)32(38-23-28-17-9-3-10-18-28)31(37-22-27-15-7-2-8-16-27)30(40-34)25-36-21-26-13-5-1-6-14-26/h1-20,30-35H,21-25H2/t30-,31-,32+,33-,34?/m1/s1 |
| InChI key |
OGOMAWHSXRDAKZ-BKJHVTENSA-N |
| mp |
151-156 °C |
| optical activity |
[α]20/D +49±2°, c = 2% in dioxane |
| shipped in |
wet ice |
| SMILES string |
OC1O[C@H](COCc2ccccc2)[C@@H](OCc3ccccc3)[C@H](OCc4ccccc4)[C@H]1OCc5ccccc5 |
| storage temp. |
−20°C |
| Other Notes: |
Important D-glucopyranose derivative for glucosylations and other reactions ; Preparation of the α-glucopyranosyl chloride ; Synthesis of 1-C-α-D-glucopyranose derivatives |
| Packaging: |
1, 5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (TLC) |
| mp |
151-156 °C |
| Storage Temp. |
−20°C |
| UNSPSC |
12352201 |
