Tetrabutylammonium acetate
ALDRICH/86849 - technical, ≥90% (T)
Synonym: TBAAc
CAS Number: 10534-59-5
Empirical Formula (Hill Notation): C18H39NO2
Molecular Weight: 301.51
EC Number: 234-101-8
MDL Number: MFCD00043208
Linear Formula: (CH3CH2CH2CH2)4N(OCOCH3)
Product Type: Chemical
| assay | ≥90% (T) |
| form | powder |
| grade | technical |
| InChI | 1S/C16H36N.C2H4O2/c1-5-9- |
| InChI key | MCZDHTKJGDCTAE-UHFFFAOYSA |
| mp | 95-98 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | CC([O-])=O.CCCC[N+](CCCC) |
| Application: | Tetrabutylammonium acetate (TBAAc) is a good source of nucleophilic acetate ion for SN2 substitution reactions. It is commonly used to displace sulfonates and allylic halides to get corresponding acetates. Additionally, TBAAc can also be used as a mild, soluble base in Sonogashira reaction and Heck arylation. |
| General description: | Tetrabutylammonium acetate is an effective alternative for sodium acetate (NaOAc) due to its good solubility in organic solvents. |
| Other Notes: | Reagent for the epimerization of hydroxyl groups; base-molten salt for directing Heck-type reactions |
| Packaging: | 10, 50 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P261 - P264 - P271 - P280 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥90% (T) |
| mp | 95-98 °C (lit.) |
| UNSPSC | 12352116 |


