Allyl p-toluenesulfonate
ALDRICH/89772 - ≥95.0% (GC)
CAS Number: 4873-09-0
Empirical Formula (Hill Notation): C10H12O3S
Molecular Weight: 212.27
EC Number: 225-480-0
MDL Number: MFCD00093777
Linear Formula: C10H12O3S
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 89772-5ML.
| assay | ≥95.0% (GC) |
| density | 1.180 g/mL at 20 °C (lit.) |
| form | liquid |
| InChI | 1S/C10H12O3S/c1-3-8-13-14 |
| InChI key | ZSBJCQGJFPHZRC-UHFFFAOYSA |
| refractive index | n |
| SMILES string | Cc1ccc(cc1)S(=O)(=O)OCC=C |
| Packaging: | 5 mL in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95.0% (GC) |
| Density | 1.180 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |