Synonym: 2-(Adamantylcyclohexylphosphino)-2’,4’,6’-triisopropyl-3,6-dimethoxybiphenyl; Cyclohexyl adamantyl(2’,4’,6’-triisopropyl-3,6-dimethoxybiphenyl-2-yl)phosphine
CAS Number: 2197989-24-3
Empirical Formula (Hill Notation): C39H57O2P
Molecular Weight: 588.84
Linear Formula: C39H57O2P
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 900278-250MG
| form |
powder |
| functional group |
phosphine |
| InChI |
InChI=1S/C39H57O2P/c1-24(2)30-19-32(25(3)4)36(33(20-30)26(5)6)37-34(40-7)14-15-35(41-8)38(37)42(31-12-10-9-11-13-31)39-21-27-16-28(22-39)18-29(17-27)23-39/h14-15,19-20,24-29,31H,9-13,16-18,21-23H2,1-8H3 |
| InChI key |
AMESLWUOCNKBCL-UHFFFAOYSA-N |
| mp |
221-224 °C |
| Quality Level |
100  |
| reaction suitability |
reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| |
reaction type: Heck Reaction |
| |
reaction type: Hiyama Coupling |
| |
reaction type: Negishi Coupling |
| |
reaction type: Sonogashira Coupling |
| |
reaction type: Stille Coupling |
| |
reaction type: Suzuki-Miyaura Coupling |
| |
reagent type: catalyst
reaction type: Cross Couplings |
| |
reagent type: ligand |
| SMILES string |
O(C1=CC=C(OC)C(=C1C=2C(=CC(=CC2C(C)C)C(C)C)C(C)C)P(C3CCCCC3)C45CC6CC(CC(C6)C4)C5)C |
| Application: |
AdCyBrettPhos can be used as a ligand in the Pd-catalyzed cross-coupling reactions. |
| Hazard statements |
H413 |
| Precautionary statements |
P273 - P501 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| mp |
221-224 °C |
| UNSPSC |
12352128 |
