CPhos Pd G4
ALDRICH/900471 - 95%
Synonym: [2′ -
CAS Number: 1810068-32-6
Empirical Formula (Hill Notation): C42H56N3O3PPdS
Molecular Weight: 820.37
MDL Number: MFCD30724404
Linear Formula: C42H56N3O3PPdS
Product Type: Chemical
| assay | 95% |
| feature | generation 4 |
| form | powder or crystals |
| functional group | phosphine |
| InChI key | ZBDSBEXQDXJAOM-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| reaction suitability | core: palladium |
| reaction type: Buchwald-Hartwig Cross Coupling Reaction | |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| reagent type: catalyst reaction type: Cross Couplings |
|
| SMILES string | [Pd+]c5c(cccc5)c6c(cccc6) |
| Application: | A fourth generation (G4) Buchwald precatalyst that is similar to the third generation (G3) precatalysts except that the amino group on the biphenyl backbone is methylated. This modification helps to prevent the limitations found when using the third generation precatalysts. It is air, moisture, and thermally-stable and shows good solubility in common organic solvents. |
| Packaging: | 1 g in glass bottle |
| Packaging: | 250 mg in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| UNSPSC | 12352103 |

