Methoxy poly(ethylene glycol)-block-poly(ε-caprolactone)
ALDRICH/900649 - 2k-2k
Synonym: mPEG-b-PCL; mPEG-PCL
Linear Formula: CH3O(CH2CH2O)n(COCH2CH2CH2CH2CH2O)mH
Product Type: Chemical
| form | powder |
| mol wt | PCL average Mn ~2,000 |
| PEG average Mn ~2,000 | |
| Quality Level | 100 ![]() |
| storage temp. | 2-8°C |
| transition temp | flash point >230 °F |
| Tm 47-51 °C |
| Application: | Biocompatible, amphiphilic block copolymer composed of a hydrophilic PEG block and a hydrophobic PCL block. These materials have been used as a block copolymer surfactant as well as in control release and nanoparticle formulation for drug delivery applications. Well-defined materials with varying properties can be prepared by controlling the relative length of each polymer block. Hydroxyl termination allows for facile further chemical modification of these materials. |
| Packaging: | 500 mg in glass insert |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | > 230.0 °F |
| Flash Point(C) | > 110 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12161904 |

