DavePhos Pd G4
ALDRICH/900702
Synonym: [2′-(Dicyclohexylphosphino-κP)-N,N-dimethyl-2-biphenylamine](methanesulfonatato-κO)[2′-(methylamino-κN)-2-biphenylyl-κC2]palladium
CAS Number: 1621274-13-2
Empirical Formula (Hill Notation): C40H51N2O3PPdS
Molecular Weight: 777.30
MDL Number: MFCD31381918
Linear Formula: C40H51N2O3PPdS
Product Type: Chemical
| feature | generation 4 |
| form | powder |
| functional group | phosphine |
| InChI | 1S/C26H36NP.C13H12N.CH4O3 |
| InChI key | HLBXHBITUASBRZ-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| reagent type: catalyst reaction type: Cross Couplings |
|
| SMILES string | [Pd+]c5c(cccc5)c6c(cccc6) |
| Application: | A powerful ligand for classic cross-coupling reactions combined with the Buchwald Fourth Generation Palladacycle. Bench stable, soluble in most organic solvents. |
| Packaging: | 1 g in glass insert |
| Packaging: | 250 mg in glass insert |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12161600 |

