Synonym: 2,5-Dioxo-1-pyrrolidinyl 4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzeneacetate
CAS Number: 1644644-96-1
Empirical Formula (Hill Notation): C15H13N5O4
Molecular Weight: 327.29
MDL Number: MFCD28334557
Linear Formula: C15H13N5O4
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 900914-100MG.
| assay |
≥95% |
| form |
powder or crystals |
| functional group |
NHS ester |
| InChI |
1S/C15H13N5O4/c1-9-16-18-15(19-17-9)11-4-2-10(3-5-11)8-14(23)24-20-12(21)6-7-13(20)22/h2-5H,6-8H2,1H3 |
| InChI key |
BIHJLZOOHNOUCG-UHFFFAOYSA-N |
| Quality Level |
100  |
| reaction suitability |
reaction type: click chemistry |
| |
reagent type: cross-linking reagent |
| SMILES string |
O=C(ON1C(CCC1=O)=O)CC(C=C2)=CC=C2C3=NN=C(C)N=N3 |
| storage temp. |
−20°C |
| Application: |
Methyltetrazine-NHS ester has an N-hydroxysuccinimide (NHS) ester that can be reacted with primary amines and a methyltetrazine, which is reactive to trans-cyclooctenes. The NHS ester reacts with primary amines (e.g. side chain of lysine residues or aminosilane-coated surfaces) at neutral or slightly basic pH to form covalent bonds. The short spacer arm adds minimal mass to modified molecules (230.2 daltons). It is generally used in click chemistry applications in bioconjugate chemistry. |
| Packaging: |
100 mg in glass insert |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95% |
| Storage Temp. |
−20°C |
| UNSPSC |
12352108 |