Synonym: (1S,2R,3R,4S,5R,6S,7S,8S)-Cubane-1,4-dicarboxylic acid; Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylic acid
CAS Number: 32846-66-5
Empirical Formula (Hill Notation): C10H8O4
Molecular Weight: 192.17
MDL Number: MFCD08458496
Linear Formula: C10H8O4
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 901000-1G.
| assay |
≥97% |
| form |
powder |
| InChI |
1S/C10H8O4/c11-7(12)9-1-2-4(9)6-5(9)3(1)10(2,6)8(13)14/h1-6H,(H,11,12)(H,13,14) |
| InChI key |
JFKXMJUMOJJTCQ-UHFFFAOYSA-N |
| mp |
224 °C |
| Quality Level |
100  |
| SMILES string |
OC([C@]12[C@H]3[C@H]4[C@@H]1[C@H]5[C@@]4(C(O)=O)[C@H]3[C@@H]52)=O |
| Symbol |
GHS06 |
| Signal word |
Danger |
| Hazard statements |
H301 |
| Precautionary statements |
P301 + P330 + P331 + P310 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97% |
| mp |
224 °C |
| UNSPSC |
12352106 |