Synonym: 1,3,2-Dioxaborolane, 2-(dichloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane; Dichloromethyl pinacol boronate
CAS Number: 83622-41-7
Empirical Formula (Hill Notation): C7H13BCl2O2
Molecular Weight: 210.89
MDL Number: MFCD27976342
Linear Formula: C7H13BCl2O2
Product Type: Chemical
| assay |
≥95% |
| density |
1.1423 |
| form |
(Powder or Solid or Crystals or Semi-Solid or Liquid) |
| functional group |
chloro |
| InChI |
1S/C7H13BCl2O2/c1-6(2)7(3,4)12-8(11-6)5(9)10/h5H,1-4H3 |
| InChI key |
GQFQFYFLABSDDS-UHFFFAOYSA-N |
| Quality Level |
100  |
| refractive index |
n/D 1.4511 |
| SMILES string |
B1(OC(C(O1)(C)C)(C)C)C(Cl)Cl |
| Application: |
Pinacol (dichloromethyl) boronate is a general reagent that was employed by Prof. Greg C. Fu and coworkers to achieve the iterative synthesis of asymmetric (secondary) alkyl boronate esters. These can be further derivatized through a growing suite of chemical transformations developed in the last decade (cross coupling, oxidation, amination, halogenation) that proceed with stereochemical fidelity. |
| Other Notes: |
A general, modular method for the catalytic asymmetric synthesis of alkylboronate esters  |
| Packaging: |
1 g in amber glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
201.2 °F |
| Flash Point(C) |
94 °C |
| Purity |
≥95% |
| Density |
1.1423 |
| Refractive Index |
n/D 1.4511 |
| UNSPSC |
12352200 |
