EPhos Pd G4
ALDRICH/901220
Synonym: [Dicyclohexyl[3-
CAS Number: 2132978-44-8
Empirical Formula (Hill Notation): C50H70NO4PPdS
Molecular Weight: 918.55
MDL Number: MFCD31692235
Linear Formula: C50H70NO4PPdS
Product Type: Chemical
| feature | generation 4 |
| form | powder or crystals |
| functional group | phosphine |
| InChI | 1S/C36H55OP.C13H12N.CH4O3 |
| InChI key | HFYQPKNKOSULDB-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| reagent type: catalyst reaction type: Cross Couplings |
|
| SMILES string | [Pd+]c5c(cccc5)c6c(cccc6) |
| Application: | Buchwald palladacycle precatalyst with EPhos ligand for Pd-catalyzed C–N cross-coupling between primary amines and aryl halides to form 2-arylaminooxazoles. Catalyst system was reported with NaOPh (CDS001581 ).It is a fourth generation (G4) Buchwald precatalyst that is similar to the third generation (G3) precatalysts except that the amino group on the biphenyl backbone is methylated. This modification helps to prevent the limitations of using the third generation precatalysts. It is air, moisture and thermally-stable and shows good solubility in common organic solvents. BrettPhos Pd G4 is highly useful in cross-coupling reactions. Some of its excellent features include lower catalyst loadings, shorter reaction time, and efficient formation of the active catalytic species and accurate control of ligand: palladium ratio. |
| Other Notes: | Mechanistic Insight Leads to a Ligand That Facilitates the Pd-Catalyzed Formation of 2-(Hetero)Arylaminooxazol![]() |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12352128 |

