RuPhos
ALDRICH/901907 - 95%
Synonym: 2-
CAS Number: 787618-22-8
Empirical Formula (Hill Notation): C30H43O2P
Molecular Weight: 466.64
MDL Number: MFCD06798294
Linear Formula: C30H43O2P
Product Type: Chemical
assay | 95% |
form | powder or crystals |
functional group | phosphine |
InChI | 1S/C30H43O2P/c1-22(2)31-2 |
InChI key | MXFYYFVVIIWKFE-UHFFFAOYSA |
mp | 123-126 °C |
125 °C | |
reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
reaction type: Heck Reaction | |
reaction type: Hiyama Coupling | |
reaction type: Negishi Coupling | |
reaction type: Sonogashira Coupling | |
reaction type: Stille Coupling | |
reaction type: Suzuki-Miyaura Coupling | |
reagent type: catalyst reaction type: Cross Couplings |
|
reagent type: ligand | |
SMILES string | CC(C)Oc1cccc(OC(C)C)c1-c2 |
Application: | Bulky phosphine ligand used in a palladium-catalyzed cross-coupling of aminoethyltrifluoroborate |
Legal Information: | Usage subject to Patents: EP 1097158; JP 5758844; CA 2336691 |
RIDADR | NONH for all modes of transport |
WGK Germany | WGK 3 |
Flash Point(F) | Not applicable |
Flash Point(C) | Not applicable |
Purity | 95% |
mp | 123-126 °C; 125 °C |
UNSPSC | 12352112 |