Hydroxy-PEG4-t-butyl ester
ALDRICH/902586
Synonym: tert-
CAS Number: 518044-32-1
Empirical Formula (Hill Notation): C15H30O7
Molecular Weight: 322.39
Linear Formula: C15H30O7
Product Type: Chemical
| assay | ≥95% |
| density | 1.04746 g/mL |
| form | liquid |
| functional group | ester |
| hydroxyl | |
| InChI | 1S/C15H30O7/c1-15(2,3)22- |
| InChI key | FJRDXEGYAVAMLB-UHFFFAOYSA |
| reaction suitability | reagent type: cross-linking reagent |
| refractive index | n |
| SMILES string | O=C(OC(C)(C)C)CCOCCOCCOCC |
| storage temp. | 2-8°C |
| Application: | This heterobifunctional, PEGylated crosslinker features a hydroxyl group at one end and t-butyl-protected carboxylic acid at the other, which can be deprotected with acidic conditions. The hydrophillic PEG linker facilitates solubility in biological applications. Hydroxy-PEG4-t-butyl ester can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or proteolysis-targeting chimeras (PROTAC® molecules) for targeted protein degradation  . |
| Legal Information: | PROTAC is a registered trademark of Arvinas Operations, Inc., and is used under license |
| Other Notes: | Recruiting cytotoxic T cells to folate-receptor-positive cancer cells  Syntheses and characterizations of novel pyrrolocoumarin probes for SNAP-tag labeling technology High density orthogonal surface immobilization via photoactivated copper-free click chemistry |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95% |
| Density | 1.04746 g/mL |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 51171641 |