[Pd(terpy)(MeCN)][BF4]2
ALDRICH/905879 - ≥95%
CAS Number: 152101-13-8
Empirical Formula (Hill Notation): C17H14B2F8N4Pd
Molecular Weight: 554.35
Linear Formula: C17H14B2F8N4Pd
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 905879-1G.
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 905879-250MG.
| assay | ≥95% |
| form | powder or crystals |
| mp | >300 °C |
| reaction suitability | core: palladium |
| reaction type: Buchwald-Hartwig Cross Coupling Reaction | |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| reagent type: catalyst | |
| SMILES string | N#CC.C1(C2=CC=CC=N2)=CC=C |
| storage temp. | 2-8°C |
| Application: | [Pd(terpy)(MeCN)][BF4]2 is a versatile palladium precatalyst. Automate your fluorination reactions with Synple Automated Synthesis Platform (SYNPLE-SC002  ) |
| Other Notes: | Palladium(III)-Catalyzed Fluorination of Arylboronic Acid Derivatives  |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95% |
| mp | >300 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12161600 |