Poly(ethylene glycol) dimethacrylate
ALDRICH/907049 - average Mn 4,000, contains MEHQ as inhibitor
Synonym: PEG bismethacrylate; PEG hydrogel; Polyethylene glycol; PEG dimethacrylate
CAS Number: 25852-47-5
MDL Number: MFCD00081877
Linear Formula: C3H5C(O)(OCH2CH2)nOC(O)C3H5
Product Type: Chemical
| Ω-end | methacrylate |
| α-end | methacrylate |
| bp | >200 °C/2 mmHg (lit.) |
| color | white to off-white |
| contains | MEHQ as inhibitor |
| ≤150 ppm MEHQ as inhibitor | |
| form | powder |
| InChI | 1S/C10H14O4/c1-7(2)9(11)1 |
| InChI key | STVZJERGLQHEKB-UHFFFAOYSA |
| mol wt | average Mn 4,000 |
| average Mn 4,000 (by NMR) | |
| polymer architecture | shape : linear functionality : homobifunctional |
| reaction suitability | reagent type: cross-linking reagent reaction type: Polymerization Reactions |
| SMILES string | OCCO.CC(=C)C(O)=O |
| storage temp. | −20°C |
| Application: | High purity PEG dimethacrylates are commonly used in PEG-based hydrogels and crosslinking hydrophilic polymers. It is good for tissue engineering and 3D printing applications. |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| bp | >200 °C/2 mmHg (lit.) |
| Storage Temp. | −20°C |
| UNSPSC | 12162002 |