Synonym: 1H,1H,2H,2H-Perfluoro-1-octanethiol; 1H,1H,2H,2H-Perfluorooctyl mercaptan
CAS Number: 34451-26-8
Empirical Formula (Hill Notation): C8H5F13S
Molecular Weight: 380.17
MDL Number: MFCD00792427
Linear Formula: CF3(CF2)5CH2CH2SH
Product Type: Chemical
| assay |
≥96.5% (GC) |
| |
97% |
| form |
liquid |
| InChI |
1S/C8H5F13S/c9-3(10,1-2-22)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h22H,1-2H2 |
| InChI key |
GTPHVVCYEWPQFE-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCS |
| Application: |
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanethiol is used to differentiate the effect on the work function and surface wetting for silver. Additionally, it can be used as a starting material to synthesize F-alkyl aroxysulfonyl carbamates and thiocarbamates. |
| General description: |
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanethiol is a fluorinated alkanethiol, which is also known as 1H,1H,2H,2H-Perfluorooctanethiol. |
| Packaging: |
1, 5 g in glass bottle |
| Purity |
≥96.5% (GC); 97% |
| UNSPSC |
12352105 |