Synonym: 5-(Acetylamino)-2-chloro-2,3,5-trideoxy-D-glycero-β-D-galacto-2-nonulopyranosonic acid methyl ester 4,7,8,9-tetraacetate; N-Acetyl-2-chloro-2-deoxy-β-neuraminic acid methyl ester 4,7,8,9-tetraacetate; Methyl N-acetyl-4,7,8,9-tetra-O-acetyl-2-chloro-2-deoxy-β-neuraminate
CAS Number: 67670-69-3
Empirical Formula (Hill Notation): C20H28ClNO12
Molecular Weight: 509.89
MDL Number: MFCD09038494
Linear Formula: C20H28ClNO12
Product Type: Chemical
| form |
solid |
| InChI |
1S/C20H28ClNO12/c1-9(23)22-16-14(31-11(3)25)7-20(21,19(28)29-6)34-18(16)17(33-13(5)27)15(32-12(4)26)8-30-10(2)24/h14-18H,7-8H2,1-6H3,(H,22,23)/t14-,15+,16+,17+,18+,20-/m0/s1 |
| InChI key |
QGJGGAMXXWIKJR-DCDDNHAVSA-N |
| shipped in |
dry ice |
| SMILES string |
COC(=O)[C@]1(Cl)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@@H](O1)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| storage temp. |
−20°C |
| Application: |
Versatile sialic acid intermediate for the preparation of neuraminic acid derivatives. N-acetylneuraminic acid is often present as the terminal sugar of glycoproteins. |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H315 |
| Hazard Codes |
Xi |
| Risk Statements |
38 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Storage Temp. |
−20°C |
| UNSPSC |
12352106 |
