3-Bromobenzenesulfonyl fluoride
ALDRICH/ALD00212 - 95% (GC)
Synonym: 3-
CAS Number: 454-65-9
Empirical Formula (Hill Notation): C6H4BrFO2S
Molecular Weight: 239.06
MDL Number: MFCD22053310
Linear Formula: C6H4BrFO2S
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: ALD00212-1G
This image depicts SKU: ALD00212-1G
| assay | 95% (GC) |
| density | 1.7355 at 25 °C |
| form | liquid |
| InChI | 1S/C6H4BrFO2S/c7-5-2-1-3- |
| InChI key | LELPUBDFQNSHLE-UHFFFAOYSA |
| Quality Level | 100  |
| reaction suitability | reaction type: click chemistry |
| refractive index | n |
| SMILES string | O=S(C1=CC=CC(Br)=C1)(F)=O |
| Application: | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. |
| Packaging: | 1 g in poly bottle |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% (GC) |
| Density | 1.7355 at 25 °C |
| Refractive Index | n |
| UNSPSC | 12352100 |