4-(2-Bromoacetyl)benzenesulfonyl fluoride
ALDRICH/ALD00364 - 95% (GC)
Empirical Formula (Hill Notation): C8H6BrFO3S
Molecular Weight: 281.10
Linear Formula: C8H6BrFO3S
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: ALD00364-1G
This image depicts SKU: ALD00364-1G
| assay | 95% (GC) |
| density | 1.705 g/cm3 at 20 °C |
| form | crystals |
| InChI | 1S/C8H6BrFO3S/c9-5-8(11)6 |
| InChI key | RWHNIEOAPNZZGI-UHFFFAOYSA |
| mp | 104-110 °C |
| Quality Level | 100  |
| reaction suitability | reaction type: click chemistry |
| SMILES string | FS(C1=CC=C(C(CBr)=O)C=C1) |
| Application: | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. |
| Packaging: | 1 g in poly bottle |
| Packaging: | 250 mg in poly bottle |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% (GC) |
| mp | 104-110 °C |
| Density | 1.705 g/cm3 at 20 °C |
| UNSPSC | 12352100 |