1-Naphthalenyl ester fluorosulfuric acid
ALDRICH/ALD00430
CAS Number: 133042-64-5
Empirical Formula (Hill Notation): C10H7FO3S
Molecular Weight: 226.22
Linear Formula: C10H7FO3S
Product Type: Chemical
| density | 1.3674 g/mL at 25 °C |
| description | Fp: >230°F |
| form | liquid |
| InChI | 1S/C10H7FO3S/c11-15(12,13 |
| InChI key | GEZWNEDYJCOWLU-UHFFFAOYSA |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | O=S(OC1=CC=CC2=CC=CC=C21) |
| Application: | The following aryl fluorosulfate can be utilized as a cross-coupling partner in Suzuki-Miyaura reactions. The standard reaction conditions for these palladium-catalyzed C-C bond formations are ligand-free and can be performed in water, at room temperature and are not air sensitive. |
| Other Notes: | Palladium-Catalyzed, Ligand-Free Suzuki Reaction in Water Using Aryl Fluorosulfates  |
| Packaging: | 500 mg in glass bottle |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260 - P280 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| RIDADR | UN 3265 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.3674 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12352100 |