Sodium (4-methoxyphenyl)methanesulfinate
ALDRICH/ALD00438
Empirical Formula (Hill Notation): C8H9NaO3S
Molecular Weight: 208.21
MDL Number: MFCD28579835
Linear Formula: C8H9NaO3S
Product Type: Chemical
| form | powder |
| InChI | 1S/C8H10O3S.Na/c1-11-8-4- |
| InChI key | OKSPESPSBLOXDC-UHFFFAOYSA |
| mp | 260-265 °C |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: C-C Bond Formation |
| SMILES string | [O-]S(CC1=CC=C(OC)C=C1)=O |
| Application: | The following Baran Sulfinate is a part of a toolbox of diversification reagents; which are ideal for the late-stage functionalization of nitrogen-containing heterocycles. The regioselectivity can be effectively tuned by modification of the pH and solvent selection. |
| Other Notes: | Radical-Based Regioselective C–H Functionalization of Electron-Deficient Heteroarenes: Scope; Tunability; and Predictability ![]() |
| Packaging: | 500 mg in amber glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H315 - H319 - H335 |
| Precautionary statements | P301 + P312 + P330 - P302 + P352 - P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 260-265 °C |
| UNSPSC | 12352112 |


