Sodium 7-Chloro-1,1-difluoroheptane-1-sulfinate
ALDRICH/ALD00484 - contains ≤15% sodium 7-(ethylthio)-1,1-difluoroheptane-1-sulfinate
Empirical Formula (Hill Notation): C7H12ClF2NaO2S
Molecular Weight: 256.67
Linear Formula: C7H12ClF2NaO2S
Product Type: Chemical
| contains | ≤15% sodium 7-(ethylthio)-1,1-difluor |
| form | powder |
| InChI | 1S/C7H13ClF2O2S.Na/c8-6-4 |
| InChI key | LFIQXRUQAPPIPD-UHFFFAOYSA |
| mp | 185 °C |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: C-C Bond Formation |
| reaction type: C-H Activation | |
| reagent type: catalyst | |
| SMILES string | O=S(C(F)(F)CCCCCCCl)O[Na] |
| Application: | The following Baran Sulfinate is a part of a toolbox of diversification reagents, which are ideal for the late-stage functionalization of nitrogen-containing heterocycles. The regioselectivity can be effectively tuned by modification of the pH and solvent selection. |
| Other Notes: | Radical-Based Regioselective C–H Functionalization of Electron-Deficient Heteroarenes: Scope, Tunability, and Predictability ![]() |
| Packaging: | 500 mg in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 185 °C |
| UNSPSC | 12352101 |


