Serine Hydrolase Inhibitor-19
ALDRICH/ALD00546
Synonym: tert-Butyl(2-(N,4-dimethyl-1H-
CAS Number: 1622426-24-7
Empirical Formula (Hill Notation): C14H24N4O3
Molecular Weight: 296.37
MDL Number: MFCD29904517
Linear Formula: C14H24N4O3
Product Type: Chemical
| form | solid |
| InChI | 1S/C14H24N4O3/c1-11-9-15- |
| InChI key | OGWFKBLFWLXJQC-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | CN(CCN(C(OC(C)(C)C)=O)C)C |
| Application: | Serine Hydrolase inhibitors are small molecule fragments that react in vitro with the serine hydrolase class of proteins. They are amenable to further modification to create novel inhibitors of this class of protein. |
| Packaging: | 5 mg in glass bottle |
| Symbol | GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301 + P330 + P331 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12352200 |


