mPEG5K-Phosphate
ALDRICH/JKA3106 - average Mn 5000
Synonym: Methoxy Polyethylene Glycol Phosphate; Polyethylene glycol
Linear Formula: CH3(CH2CH2O)nCH2CH2OPO(OH)2
Product Type: Chemical
| form | solid |
| mol wt | average Mn 5000 |
| storage temp. | −20°C |
| Application: | Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization |
| Legal Information: | Product of JenKem Technology |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | −20°C |
| UNSPSC | 51171641 |

