4arm-PEG40K-NH2
ALDRICH/JKA7024 - HCl Salt, average Mn 40,000
Synonym: 4arm-PEG-NH2; 4arm-PEG-amine; Polyethylene glycol
Linear Formula: C(CH2O(CH2CH2O)nCH2CH2NH2HCl)4
Product Type: Chemical
| form | solid |
| mol wt | average Mn 40,000 |
| polymer architecture | shape : 4-arm functionality : homofunctional |
| reaction suitability | reactivity: carboxyl reactive |
| storage temp. | −20°C |
| Application: | Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization |
| General description: | 4arm PEG Amine. Hydrogel PEG. Amine group binds to carboxylic group (-COOH) or other amine reactive chemical groups. |
| Legal Information: | Product of JenKem Technology |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | −20°C |
| UNSPSC | 12162002 |
