(±)-Naringenin
ALDRICH/N5893 - ≥95%
Synonym: (±)
CAS Number: 67604-48-2
Empirical Formula (Hill Notation): C15H12O5
Molecular Weight: 272.25
EC Number: 266-769-1
MDL Number: MFCD00006844
Linear Formula: C15H12O5
Product Type: Chemical
| assay | ≥95% |
| form | powder |
| InChI | 1S/C15H12O5/c16-9-3-1-8(2 |
| InChI key | FTVWIRXFELQLPI-UHFFFAOYSA |
| mp | 247-250 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | OC1=CC=C(C=C1)C(C2)OC3=CC |
| Application: | (±)-Naringenin, a polyphenolic material, is used to prepare nickel(II) naringenin-oxime complex, which can be used as a catalyst for Mizoroki−Heck cross-coupling reaction. It has been used as a hypochlorite scavenger to prevent the formation of chloramines from oxidation of hypochlorite in the human serum albumin. It induces apoptosis in human pancreatic cancer SNU-213 cells. It also shows cytotoxic effects on various human cancer cells such as breast, cervix, stomach, colon and liver cancer cells. |
| Packaging: | 1 g in poly tube |
| Packaging: | 5, 25 g in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264 - P270 - P301 + P312 - P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95% |
| mp | 247-250 °C (lit.) |
| UNSPSC | 12352100 |


