Oleanolic acid
ALDRICH/O5504 - ≥97%
Synonym: (+)-Oleanolic acid; 3beta-
CAS Number: 508-02-1
Empirical Formula (Hill Notation): C30H48O3
Molecular Weight: 456.70
EC Number: 208-081-6
MDL Number: MFCD00064914
Linear Formula: C30H48O3
Product Type: Chemical
| assay | ≥97% |
| color | light yellow |
| form | powder |
| InChI | 1S/C30H48O3/c1-25(2)14-16 |
| InChI key | MIJYXULNPSFWEK-GTOFXWBISA |
| mp | >300 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | [H][C@@]12CC(C)(C)CC[C@@] |
| storage temp. | 2-8°C |
| Application: | Oleanolic acid has been used as a reference compound during its quantification in the roots of Cissampelos pareria Linn.var hirsuta by high performance thin layer chromatography (HPTLC). |
| Biochem/physiol Actions: | Triterpenoid isolated from medicinal plants. Antitumor and hepatoprotective agent. Oleanolic acid has therapeutic potential for neurodegenerative diseases. |
| General description: | Oleanolic acid is a hydroxyl pentacyclic triterpenoic acid (HPTA), which exhibits antibacterial, antitumor and antileishmanial activity. |
| Packaging: | 100, 500 mg in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Purity | ≥97% |
| mp | >300 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352002 |

