Phosphomolybdic acid solution
ALDRICH/P4869 - spray reagent, 10% in ethanol
Synonym: Molybdophosphoric acid
CAS Number: 12026-57-2
Empirical Formula (Hill Notation): H3Mo12O40P
Molecular Weight: 1825.25
MDL Number: MFCD00011341
Linear Formula: H3[P(Mo3O10)4]
Product Type: Chemical
| concentration | 10% in ethanol |
| InChI | 1S/12Mo.H3O4P.36O/c;;;;;; |
| InChI key | DHRLEVQXOMLTIM-UHFFFAOYSA |
| packaging | pkg of 100 mL |
| Quality Level | 200 ![]() |
| reaction suitability | reagent type: oxidant |
| SMILES string | O=[Mo](=O)=O.O=[Mo](=O)=O |
| storage temp. | 2-8°C |
| Application: | For the detection of lipids, steroids, lactones, keto acids, hydroxy acids, unsaturated fatty acids, and phenolic compounds. |
| Other Notes: | 10% Phosphomolybdic acid in ethanol |
| Symbol | ![]() ![]() GHS02,GHS03,GHS05 |
| Signal word | Danger |
| Hazard statements | H225 - H272 - H314 |
| Precautionary statements | P210 - P220 - P233 - P280 - P303 + P361 + P353 - P305 + P351 + P338 |
| Hazard Codes | O,F,C |
| Risk Statements | 8-11-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2924 8(3) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 55.0 °F - closed cup |
| Flash Point(C) | 12.8 °C - closed cup |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352301 |




