Phthalimidooxy-dPEG®4-NHS ester
ALDRICH/QBD10011
Empirical Formula (Hill Notation): C23H28N2O11
Molecular Weight: 508.48
MDL Number: MFCD28155511
Linear Formula: C23H28N2O11
Product Type: Chemical
| assay | >90% |
| form | solid or viscous liquid |
| functional group | NHS ester |
| InChI | 1S/C23H28N2O11/c26-19-5-6 |
| InChI key | HLAGLPXQSIDIDX-UHFFFAOYSA |
| polymer architecture | shape : linear functionality : heterobifunctional |
| reaction suitability | reactivity: amine reactive |
| reagent type: cross-linking reagent reactivity: thiol reactive |
|
| shipped in | ambient |
| SMILES string | O=C(ON1C(CCC1=O)=O)CCOCCO |
| storage temp. | −20°C |
| Features and Benefits: | Phthalimidooxy-dPEG®4-NHS ester allows introduction of an oxyamine function onto a target molecule for cross-linking proteins or for creating stable conjugates with the target molecule. The oxyamine function is protected by a phthalimido protecting group on one end of the spacer arm, and the spacer is installed on the target molecule with the amine-reactive N-hydroxysuccinimide (NHS) group on the other end of the spacer. The single molecular weight dPEG® spacers have precise length for spatial control. They are hydrophilic and non-immunogenic. The dPEG® spacers improve water solubility and reduce aggregation and precipitation of proteins. The phthalimido protecting group can be removed using hydrazine. The oxyamine group exposed after deprotection can be reacted with an aldehyde- or ketone-containing molecule to form an oxime bond linking the two molecules. These reagents can be used with any protein, peptide, or small molecule that has a free amine. |
| Legal Information: | dPEG is a registered trademark of Quanta BioDesign |
| Legal Information: | Products Protected under U.S. Patents # 7,888,536 B2 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >90% |
| Storage Temp. | −20°C |
| UNSPSC | 12352108 |
