Amino-dPEG®6-acid
ALDRICH/QBD10067
Synonym: 1-
CAS Number: 905954-28-1
Empirical Formula (Hill Notation): C15H31NO8
Molecular Weight: 353.41
MDL Number: MFCD13184943
Linear Formula: C15H31NO8
Product Type: Chemical
| assay | >90% |
| form | solid or viscous liquid |
| functional group | amine |
| carboxylic acid | |
| InChI | 1S/C15H31NO8/c16-2-4-20-6 |
| InChI key | PVRGRRPCHFTMMD-UHFFFAOYSA |
| polymer architecture | shape : linear functionality : heterobifunctional |
| reaction suitability | reagent type: cross-linking reagent reactivity: carboxyl reactive |
| shipped in | ambient |
| SMILES string | NCCOCCOCCOCCOCCOCCOCCC(O) |
| storage temp. | −20°C |
| Features and Benefits: | Amino-dPEG®6-acid is a novel amino acid that can be manipulated, modified, and used like most other amino acids. The single molecular weight dPEG® spacer arms between the terminal amine and the terminal carboxylic acid are of exact length (25.1 Å), allowing for precise spatial control, and they are hydrophilic and non-immunogenic, imparting greater water solubility and hydrodynamic volume to target molecules. |
| Legal Information: | dPEG is a registered trademark of Quanta BioDesign |
| Legal Information: | Products Protected under U.S. Patents # 7,888,536 B2 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >90% |
| Storage Temp. | −20°C |
| UNSPSC | 12352106 |