Azido-dPEG®4-NHS ester
ALDRICH/QBD10501
Synonym: 3-
CAS Number: 944251-24-5
Empirical Formula (Hill Notation): C15H24N4O8
Molecular Weight: 388.37
MDL Number: MFCD13184948
Linear Formula: C15H24N4O8
Product Type: Chemical
| assay | >90% |
| form | solid or viscous liquid |
| functional group | azide |
| NHS ester | |
| InChI | 1S/C15H24N4O8/c16-18-17-4 |
| InChI key | OIGKWPIMJCPGGD-UHFFFAOYSA |
| polymer architecture | shape : linear functionality : heterobifunctional |
| reaction suitability | reaction type: click chemistry |
| reagent type: cross-linking reagent reaction type: click chemistry |
|
| shipped in | ambient |
| SMILES string | O=C(ON1C(CCC1=O)=O)CCOCCO |
| storage temp. | −20°C |
| Features and Benefits: | The azido-dPEG®4-NHS ester contains an azide function on one end of a single molecular weight dPEG® spacer (17.7 Å) and a reactive group on the other end of the spacer. The dPEG® spacer is hydrophilic and non-immunogenic and improves the water solubility of the target molecule while reducing the immunogenicity and increasing the hydrodynamic volume of the target. NHS ester readily reacts with amines in aqueous solution or organic solvent. The azide group reacts with an alkyne in the well-known click chemistry reaction. The click chemistry reaction proceeds by copper(I) or ruthenium catalysis or in a strain-catalyzed reaction with certain types of alkyne partners. |
| Legal Information: | dPEG is a registered trademark of Quanta BioDesign |
| Legal Information: | Products Protected under U.S. Patents # 7,888,536 B2 |
| RIDADR | NONH for all modes of transport |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >90% |
| Storage Temp. | −20°C |
| UNSPSC | 12352108 |
