Azido-dPEG®8-NHS ester
ALDRICH/QBD10503
Synonym: 2,5-
CAS Number: 1204834-00-3
Empirical Formula (Hill Notation): C23H40N4O12
Molecular Weight: 564.58
MDL Number: MFCD13184949
Linear Formula: C23H40N4O12
Product Type: Chemical
| assay | >90% |
| form | solid or viscous liquid |
| functional group | azide |
| NHS ester | |
| polymer architecture | shape : linear functionality : heterobifunctional |
| reaction suitability | reaction type: click chemistry |
| reagent type: cross-linking reagent reaction type: click chemistry |
|
| shipped in | ambient |
| SMILES string | O=C(ON1C(CCC1=O)=O)CCOCCO |
| storage temp. | −20°C |
| Features and Benefits: | The azido-dPEG®8-NHS ester contains an azide function on one end of a single molecular weight dPEG® spacer(32.2 Å) and a reactive group (NHS ester) on the other end of the spacer. The dPEG® spacer is hydrophilic and non-immunogenic and improves the water solubility of the target molecule while reducing the immunogenicity and increasing the hydrodynamic volume of the target. N-hydroxysuccinimide (NHS) ester readily react with amines in aqueous solution or organic solvent. The azide group reacts with an alkyne in the well-known click chemistry reaction. The click chemistry reaction proceeds by copper(I) or ruthenium catalysis or in a strain-catalyzed reaction with certain types of alkyne partners. |
| Legal Information: | dPEG is a registered trademark of Quanta BioDesign |
| Legal Information: | Products Protected under U.S. Patents # 7,888,536 B2 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >90% |
| Storage Temp. | −20°C |
| UNSPSC | 12161502 |