Lipoamido-dPEG®8-TFP ester
ALDRICH/QBD10642
Empirical Formula (Hill Notation): C33H51F4NO11S2
Molecular Weight: 777.88
Linear Formula: C33H51F4NO11S2
Product Type: Chemical
| assay | >90% |
| form | solid or viscous liquid |
| polymer architecture | shape : linear functionality : heterobifunctional |
| reaction suitability | reaction type: Pegylations |
| reagent type: chemical modification reagent | |
| reagent type: cross-linking reagent reactivity: gold reactive |
|
| shipped in | ambient |
| SMILES string | O=C(CCCCC1CCSS1)NCCOCCOCC |
| storage temp. | −20°C |
| Features and Benefits: | Lipoamido-dPEG®8-TFP ester permits crosslinking of a molecule with an amine functional group to a metal surface such as gold. The lipoamide group readily forms strong, stable dative bonds with metals such as gold, while 2,3,5,6-tetrafluorophenyl (TFP) ester group reacts with amines. The dPEG® spacers are hydrophilic, non-immunogenic, single molecular weight compounds of exact length. Precise spacing control of the crosslinked molecules is possible because of this single molecular weight nature. The dPEG® spacers also improve the water solubility of the target molecules. |
| Legal Information: | dPEG is a registered trademark of Quanta BioDesign |
| Legal Information: | Products Protected under U.S. Patents # 7,888,536 B2 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >90% |
| Storage Temp. | −20°C |
| UNSPSC | 12352108 |