Biotin-dPEG®23-MAL
ALDRICH/QBD10785
Synonym: Polyethylene glycol
Empirical Formula (Hill Notation): C65H119N5O28S
Molecular Weight: 1450.72
Linear Formula: C65H119N5O28S
Product Type: Chemical
| assay | >90% |
| form | solid or viscous liquid |
| InChI | 1S/C65H119N5O28S/c71-60(4 |
| InChI key | YUDZHUVXVXAVNG-UHFFFAOYSA |
| polymer architecture | shape : linear functionality : monofunctional |
| reaction suitability | reaction type: Biotinylations reactivity: thiol reactive |
| reagent type: cross-linking reagent | |
| shipped in | ambient |
| SMILES string | O=C(CCCCC1SCC(N2)C1NC2=O) |
| storage temp. | −20°C |
| Features and Benefits: | Biotin-dPEG®23-MAL takes advantage of the well-known, specific Michael reaction between a maleimide group and a free sulfhydryl to allow site-specific biotin labeling of molecules in aqueous media within the pH range of 6.5 – 7.5. The single molecular weight dPEG® spacer (94.1 Å) provide precise spacing between the biotin moiety and the labeled molecule. The dPEG® spacer imparts water solubility to the labeled molecule while reducing immunogenicity, aggregation, and precipitation of labeled biomolecules or other labeled compounds. |
| Legal Information: | dPEG is a registered trademark of Quanta BioDesign |
| Legal Information: | Products Protected under U.S. Patents # 7,888,536 B2 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >90% |
| Storage Temp. | −20°C |
| UNSPSC | 51171641 |