Biotin-dPEG®23-NH2
ALDRICH/QBD10786
Synonym: Polyethylene glycol
Empirical Formula (Hill Notation): C58H114N4O25S
Molecular Weight: 1299.60
MDL Number: MFCD26793760
Linear Formula: C58H114N4O25S
Product Type: Chemical
| assay | >90% |
| form | solid or viscous liquid |
| InChI key | LQIGDDHILHLQSX-UHFFFAOYSA |
| polymer architecture | shape : linear functionality : monofunctional |
| reaction suitability | reaction type: Biotinylations |
| reagent type: cross-linking reagent | |
| shipped in | ambient |
| SMILES string | O=C(CCCCC1SCC(N2)C1NC2=O) |
| storage temp. | −20°C |
| Features and Benefits: | Biotin-dPEG®23-amine is a single molecular weight dPEG® containing a terminal primary amine that permit biotin labeling with precise spacing to molecules containing a free carboxylic acid or aldehyde group. For small peptides and small molecules, the labeling can be site specific, while for larger molecules such as proteins, the labeling may be more random. The single molecular weight nature of the dPEG® spacer (87 Å) allows the user to precisely tailor the distance between the biotin and the target molecule in order to receive optimal binding between biotin and avidin. |
| Legal Information: | dPEG is a registered trademark of Quanta BioDesign |
| Legal Information: | Products Protected under U.S. Patents # 7,888,536 B2 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >90% |
| Storage Temp. | −20°C |
| UNSPSC | 51171641 |
