Biotin-dPEG®23-azide
ALDRICH/QBD10787
Synonym: Polyethylene glycol
Empirical Formula (Hill Notation): C58H112N6O25S
Molecular Weight: 1325.60
Linear Formula: C58H112N6O25S
Product Type: Chemical
| assay | >90% |
| form | solid or viscous liquid |
| InChI key | BXCVJZZLKSMPOQ-UHFFFAOYSA |
| polymer architecture | shape : linear functionality : monofunctional |
| reaction suitability | reaction type: Biotinylations |
| reagent type: cross-linking reagent | |
| shipped in | ambient |
| SMILES string | O=C(CCCCC1SCC(N2)C1NC2=O) |
| storage temp. | −20°C |
| Features and Benefits: | Biotin-dPEG®23-azide is a single molecular weight dPEG® that permits biotin labeling with precise spacing to molecules containing an alkyne using well-known, highly popular click chemistry. By inserting an alkyne function into the target molecule, site specific labeling can occur using either copper(I) catalyzed or strain-catalyzed click chemistry. The single molecular weight nature of the dPEG® spacer (87.7 Å) allows the user to precisely tailor the distance between the biotin and the target molecule in order to receive optimal binding between biotin and avidin. |
| Legal Information: | dPEG is a registered trademark of Quanta BioDesign |
| Legal Information: | Products Protected under U.S. Patents # 7,888,536 B2 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >90% |
| Storage Temp. | −20°C |
| UNSPSC | 12352125 |
