Synonym: 1,2-Dideoxy-3,4,6-tri-O-acetyl-D-arabino-1-hexenopyranose; 3,4,6-Tri-O-acetyl-1,5-anhydro-2-deoxy-D-arabino-hex-1-enitol
CAS Number: 2873-29-2
Empirical Formula (Hill Notation): C12H16O7
Molecular Weight: 272.25
EC Number: 220-709-0
MDL Number: MFCD00063253
Linear Formula: C12H16O7
Product Type: Chemical
| assay |
98% |
| form |
crystalline powder |
| InChI |
1S/C12H16O7/c1-7(13)17-6-11-12(19-9(3)15)10(4-5-16-11)18-8(2)14/h4-5,10-12H,6H2,1-3H3/t10-,11-,12+/m1/s1 |
| InChI key |
LLPWGHLVUPBSLP-UTUOFQBUSA-N |
| mp |
53-55 °C (lit.) |
| optical activity |
[α]25/D −12°, c = 2 in ethanol |
| Quality Level |
200  |
| SMILES string |
CC(=O)OC[C@H]1OC=C[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| Application: |
Important building block for both solution- and solid-phase synthesis of oligosaccharides. |
| Packaging: |
25, 100 g in poly bottle |
| Packaging: |
5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
98% |
| mp |
53-55 °C (lit.) |
| UNSPSC |
12352201 |