Triphenylantimony(III)
ALDRICH/T81809 - 99%
Synonym: Antimony(III)
CAS Number: 603-36-1
Empirical Formula (Hill Notation): C18H15Sb
Molecular Weight: 353.07
EC Number: 210-037-6
MDL Number: MFCD00003000
Linear Formula: (C6H5)3Sb
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: T81809-100G
| assay | 99% |
| bp | 377 °C (lit.) |
| form | solid |
| InChI | 1S/3C6H5.Sb/c3*1-2-4-6-5- |
| InChI key | HVYVMSPIJIWUNA-UHFFFAOYSA |
| mp | 52-54 °C (lit.) |
| Quality Level | 200  |
| reaction suitability | core: antimony |
| reagent type: catalyst | |
| SMILES string | c1ccc(cc1)[Sb](c2ccccc2)c |
| General description: | Atomic number of base material: 51 Antimony |
| Packaging: | 25, 100 g in glass bottle |
| Symbol |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 + H332 - H411 |
| Precautionary statements | P273 - P301 + P312 + P330 - P304 + P340 + P312 |
| Hazard Codes | Xn,N |
| Risk Statements | 20/22-51/53 |
| Safety Statements | 61 |
| RIDADR | UN3467 - class 6.1 - PG 3 - EHS - Organometallic compound, toxic |
| WGK Germany | WGK 2 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | 99% |
| bp | 377 °C (lit.) |
| mp | 52-54 °C (lit.) |
| UNSPSC | 12352103 |