Triphenylphosphine oxide
ALDRICH/T84603 - 98%
Synonym: Ph3PO; TPPO; Triphenyl phosphorus oxide; Triphenylphosphine monoxide
CAS Number: 791-28-6
Empirical Formula (Hill Notation): C18H15OP
Molecular Weight: 278.28
EC Number: 212-338-8
MDL Number: MFCD00002080
Linear Formula: (C6H5)3PO
Product Type: Chemical
| assay | 98% |
| functional group | phosphine oxide |
| InChI | 1S/C18H15OP/c19-20(16-10- |
| InChI key | FIQMHBFVRAXMOP-UHFFFAOYSA |
| mp | 150-157 °C (lit.) |
| Quality Level | 200 ![]() |
| reaction suitability | reagent type: ligand reaction type: Coupling Reactions |
| reagent type: ligand reaction type: Epoxidations |
|
| reagent type: ligand reaction type: Michael Reaction |
|
| SMILES string | O=P(c1ccccc1)(c2ccccc2)c3 |
| Application: | Triphenylphosphine oxide can be used: • As a catalyst in Appel-type chlorination reaction of acyclic primary and secondary alcohols. • As a catalyst in stereoselective poly and dibromination of α,β-unsaturated esters and β,γ-unsaturated α-ketoester compounds. • As a promotor in the diastereoselective synthesis of α-ribofuranosides through ribofuranosylation of alcohols with ribofuranosyl iodides. |
| Packaging: | 25, 100 g in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H412 |
| Precautionary statements | P264 - P270 - P273 - P301 + P312 - P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 356.0 °F |
| Flash Point(C) | 180 °C |
| Purity | 98% |
| mp | 150-157 °C (lit.) |
| UNSPSC | 12352002 |


