Isoamyl butyrate
ALDRICH/W206008 - ≥98%, FCC, FG
Synonym: 3-methylbutyl butanoate; 3-methylbutyl butyrate
CAS Number: 106-27-4
Empirical Formula (Hill Notation): C9H18O2
Molecular Weight: 158.24
EC Number: 203-380-8
MDL Number: MFCD00044888
Linear Formula: CH3CH2CH2CO2CH2CH2CH(CH3)2
Product Type: Chemical
| agency | meets purity specifications of JECFA |
| application(s) | flavors and fragrances |
| assay | ≥98% |
| biological source | synthetic |
| bp | 184-185 °C (lit.) |
| density | 0.862 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/C9H18O2/c1-4-5-9(10)11 |
| InChI key | PQLMXFQTAMDXIZ-UHFFFAOYSA |
| organoleptic | green; tropical; fruity |
| Quality Level | 300  |
| 400 |
|
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FCC | |
| FDA 21 CFR 117 | |
| FDA 21 CFR 172.515 | |
| SMILES string | CCCC(=O)OCCC(C)C |
| vapor density | 5.45 (vs air) |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 9, 20 kg in composite drum |
| Symbol |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 - H412 |
| Precautionary statements | P210 - P233 - P240 - P241 - P242 - P273 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3272 3 / PGIII |
| WGK Germany | WGK 1 |
| Flash Point(F) | 138.2 °F |
| Flash Point(C) | 59 °C |
| Purity | ≥98% |
| bp | 184-185 °C (lit.) |
| Density | 0.862 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2060 |
| UNSPSC | 12164502 |