Isoamyl cinnamate
ALDRICH/W206318 - ≥97%, FG
Synonym: Isopentyl cinnamate; Isoamyl 3-phenyl propenoate
CAS Number: 7779-65-9
Empirical Formula (Hill Notation): C14H18O2
Molecular Weight: 218.29
EC Number: 231-931-2
MDL Number: MFCD00026518
Linear Formula: C6H5CH=CHCO2CH2CH2CH(CH3)2
Product Type: Chemical
| agency | follows IFRA guidelines |
| meets purity specifications of JECFA | |
| application(s) | flavors and fragrances |
| assay | ≥97% |
| biological source | synthetic |
| bp | 310 °C (lit.) |
| density | 0.995 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | no known allergens |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| InChI | 1S/C14H18O2/c1-12(2)10-11 |
| InChI key | JFHCDEYLWGVZMX-CMDGGOBGSA |
| organoleptic | cocoa; balsamic |
| Quality Level | 300  |
| 400 |
|
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| FDA 21 CFR 117 | |
| FDA 21 CFR 172.515 | |
| SMILES string | CC(C)CCOC(=O)C=Cc1ccccc |
| General description: | Isoamyl cinnamate is mainly used as a fragrance ingredient and also as a food flavoring agent. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 10 kg in poly drum |
| Packaging: | 25 kg in composite drum |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | ≥97% |
| bp | 310 °C (lit.) |
| Density | 0.995 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2063 |
| UNSPSC | 12164502 |