Butylated hydroxyanisole
ALDRICH/W218308 - 99%, FCC, FG
Synonym: 2(3)-t-
CAS Number: 25013-16-5
Empirical Formula (Hill Notation): C11H16O2
Molecular Weight: 180.24
EC Number: 246-563-8
MDL Number: MFCD01779059
Linear Formula: (CH3)3CC6H3(OCH3)OH
Product Type: Chemical
| agency | follows IFRA guidelines |
| application(s) | flavors and fragrances |
| assay | 99% |
| autoignition temp. | 599 °F |
| biological source | synthetic |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | no known allergens |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| InChI | 1S/C11H16O2/c1-11(2,3)9-7 |
| InChI key | MRBKEAMVRSLQPH-UHFFFAOYSA |
| mp | 58-60 °C (lit.) |
| organoleptic | mild |
| Quality Level | 300 ![]() |
400 ![]() |
|
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1333/2008 & 178/2002 | |
| FCC | |
| FDA 21 CFR 117 | |
| FDA 21 CFR 172.515 | |
| SMILES string | O(C)c1cc(c(cc1)O)C(C)(C)C |
| vapor density | 6.2 (vs air) |
| Application: |
|
| General description: | Butylated hydroxyanisole is a volatile monohydric phenolic compound mainly used as an antioxidant and preservative in the food industry. It is used to preserve the flavor and color of oils due its ability to restrict the oxidation of short chain fatty acids. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 100 g in poly bottle |
| Packaging: | 5 kg in poly drum |
| Symbol | ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 - H411 |
| Precautionary statements | P264 - P270 - P273 - P301 + P312 - P391 - P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-40 |
| Safety Statements | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 241.9 °F - Pensky-Martens c |
| Flash Point(C) | 116.6 °C - Pensky-Martens c |
| Purity | 99% |
| mp | 58-60 °C (lit.) |
| FEMA Number | 2183 |
| UNSPSC | 12164502 |



