Caffeine
ALDRICH/W222402 - anhydrous, 99%, FCC, FG
Synonym: 1,3,7-
CAS Number: 58-08-2
Empirical Formula (Hill Notation): C8H10N4O2
Molecular Weight: 194.19
EC Number: 200-362-1
MDL Number: MFCD00005758
Linear Formula: C8H10N4O2
Product Type: Chemical
| application(s) | flavors and fragrances |
| assay | 99% |
| biological source | synthetic |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| form | powder |
| grade | anhydrous |
| FG | |
| Halal | |
| Kosher | |
| InChI | 1S/C8H10N4O2/c1-10-4-9-6- |
| InChI key | RYYVLZVUVIJVGH-UHFFFAOYSA |
| mp | 234-236.5 °C (lit.) |
| organoleptic | odorless |
| Quality Level | 400  |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FCC | |
| FDA 21 CFR 182.1180 | |
| SMILES string | CN1C(=O)N(C)c2ncn(C)c2C1= |
| solubility | H2O: soluble 18.7 g/L at 16 °C |
| Application: |
|
| General description: | Caffeine is an addictive psychoactive compound, consumed mostly in the form of brewed coffee, instant coffee, tea and caffeinated soft drinks. Caffeine is reported to be an allergen and causes anaphylaxis. It is added to common analgesics such as paracetamol, ibuprofen and aspirin for enhancing their analgesic efficacy. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 10, 25 kg in fiber drum |
).| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301 + P312 + P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 234-236.5 °C (lit.) |
| FEMA Number | 2224 |
| UNSPSC | 12164502 |