L-Carvone
ALDRICH/W224901 - ≥97%, FCC, FG
Synonym: (R)-(−)-Carvone; (−)-Carvone; (R)
CAS Number: 6485-40-1
Empirical Formula (Hill Notation): C10H14O
Molecular Weight: 150.22
EC Number: 229-352-5
MDL Number: MFCD00001578
Linear Formula: C10H14O
Product Type: Chemical
| agency | follows IFRA guidelines |
| meets purity specifications of JECFA | |
| application(s) | flavors and fragrances |
| assay | ≥97% |
| biological source | synthetic |
| bp | 227-230 °C (lit.) |
| composition | contains IFRA restricted Carvone |
| density | 0.959 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | carvone |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| InChI | 1S/C10H14O/c1-7(2)9-5-4-8 |
| InChI key | ULDHMXUKGWMISQ-SECBINFHSA |
| optical activity | [α]20/D −61°, neat |
| organoleptic | herbaceous; spearmint |
| Quality Level | 300  |
| 400 |
|
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| FCC | |
| FDA 21 CFR 117 | |
| SMILES string | CC(=C)[C@@H]1CC=C(C)C(=O) |
| vapor density | 5.2 (vs air) |
| vapor pressure | 0.4 mmHg ( 20 °C) |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 5 kg in poly drum |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H317 |
| Precautionary statements | P261 - P264 - P270 - P280 - P301 + P312 - P302 + P352 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 192.2 °F - closed cup |
| Flash Point(C) | 89 °C - closed cup |
| Purity | ≥97% |
| bp | 227-230 °C (lit.) |
| Density | 0.959 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2249 |
| UNSPSC | 12164502 |