Citric acid
ALDRICH/W230618 - ≥99.5%, FCC, FG
CAS Number: 77-92-9
Empirical Formula (Hill Notation): C6H8O7
Molecular Weight: 192.12
EC Number: 201-069-1
MDL Number: MFCD00011669
Linear Formula: HOC(COOH)(CH2COOH)2
Product Type: Chemical
| application(s) | flavors and fragrances |
| assay | ≥99.5% |
| biological source | synthetic |
| cation traces | As: ≤3.0 ppm |
| Cd: ≤1.0 ppm | |
| Hg: ≤1.0 ppm | |
| Pb: ≤0.5 ppm | |
| documentation | see Safety & Documentation for available documents |
| expl. lim. | 8 %, 65 °F |
| food allergen | no known allergens |
| form | powder or granules |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/C6H8O7/c7-3(8)1-6(13,5 |
| InChI key | KRKNYBCHXYNGOX-UHFFFAOYSA |
| mp | 153-159 °C (lit.) |
| organoleptic | odorless |
| pKa | (1) 3.13, (2) 4.76, (3) 6.4 |
| Quality Level | 400  |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FCC | |
| FDA 21 CFR 117 | |
| FDA 21 CFR 184.1033 | |
| SMILES string | OC(=O)CC(O)(CC(O)=O)C(O)= |
| solubility | water: 383 g/L at 25 °C |
| General description: | Citric acid is an important organic acid that is extensively used in the food industry as a pH control agent, flavor modifier, an antimicrobial agent, a leavening agent and as an antioxidant. The treatment of potato-based foods with a combination of citric acid and glycine in low concentration may reduce the formation of acrylamide with minimal effect on the flavor. Citric acid is also an effective anti-browning agent of food and beverages due to its ability to inhibit the activity of polyphenol oxidase (PPO) enzyme responsible for browning. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 10, 25 kg in fiber drum |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264 - P280 - P305 + P351 + P338 - P337 + P313 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.5% |
| mp | 153-159 °C (lit.) |
| FEMA Number | 2306 |
| UNSPSC | 12164502 |