α,α-Dimethylphenethyl butyrate
ALDRICH/W239402 - ≥95%, FCC, FG
Synonym: (1-
CAS Number: 10094-34-5
Empirical Formula (Hill Notation): C14H20O2
Molecular Weight: 220.31
EC Number: 233-221-8
MDL Number: MFCD00027132
Linear Formula: CH3CH2CH2CO2C(CH3)2CH2C6H5
Product Type: Chemical
| agency | meets requirements for JECFA |
| application(s) | flavors and fragrances |
| assay | ≥95% |
| biological source | synthetic |
| bp | 237-255 °C (lit.) |
| density | 0.969 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/C14H20O2/c1-4-8-13(15) |
| InChI key | SHSGYHAHMQLYRB-UHFFFAOYSA |
| organoleptic | green; fruity; floral; herbaceous |
| Quality Level | 300  |
| 400 |
|
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FCC | |
| FDA 21 CFR 117 | |
| FDA 21 CFR 172.515 | |
| SMILES string | CCCC(=O)OC(C)(C)Cc1ccccc1 |
| General description: | α,α-Dimethylphenethyl butyrate belongs to the fragrance structural group aryl alkyl alcohol simple acid esters (AAASAE). The compound has a mild, herbaceous odor. It is a fragrance ingredient used in various non-cosmetic products, such as detergents, household cleansers, and shampoos. It is also found in decorative cosmetics, toiletries, and shampoos. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 5, 10 kg in poly drum |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H412 |
| Precautionary statements | P273 - P302 + P352 |
| Hazard Codes | Xi,N |
| Risk Statements | 38-43-51/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | 242.6 °F - closed cup |
| Flash Point(C) | 117 °C - closed cup |
| Purity | ≥95% |
| bp | 237-255 °C (lit.) |
| Density | 0.969 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2394 |
| UNSPSC | 12164502 |