Synonym: Butyric acid geranyl ester; Trans-3,7-dimethyl-2,6-octadien-1-yl butyrate; [(2E)-3,7-dimethylocta-2,6-dienyl] butanoate
CAS Number: 106-29-6
Empirical Formula (Hill Notation): C14H24O2
Molecular Weight: 224.34
EC Number: 203-381-3
MDL Number: MFCD00036538
Linear Formula: CH3CH2CH2CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2
Product Type: Chemical
| application(s) |
flavors and fragrances |
| assay |
≥95% |
| bp |
151-153 °C/18 mmHg (lit.) |
| density |
0.896 g/mL at 25 °C (lit.) |
| documentation |
see Safety & Documentation for available documents |
| food allergen |
no known allergens |
| grade |
Kosher |
| impurities |
<35% citronellyl and neryl butyrates |
| InChI |
1S/C14H24O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h8,10H,5-7,9,11H2,1-4H3/b13-10+ |
| InChI key |
ZSBOMYJPSRFZAL-JLHYYAGUSA-N |
| organoleptic |
apple; fruity; waxy; rose; sweet |
| Quality Level |
400  |
| refractive index |
n20/D 1.461 (lit.) |
| reg. compliance |
FCC |
| |
FDA 21 CFR 117 |
| |
FDA 21 CFR 172.515 |
| SMILES string |
[H]C(CCC(C)=C(/[H])COC(=O)CCC)=C(/C)C |
| Disclaimer: |
For R&D or non-EU Food use. Not for retail sale. |
| Packaging: |
1 kg in poly bottle |
| Packaging: |
9 kg in poly drum |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H335 |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26-36 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
235.4 °F - closed cup |
| Flash Point(C) |
113 °C - closed cup |
| Purity |
≥95% |
| bp |
151-153 °C/18 mmHg (lit.) |
| Density |
0.896 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.461 (lit.) |
| FEMA Number |
2512 |
| UNSPSC |
12164502 |
