Geranyl butyrate
ALDRICH/W251216 - natural, ≥95%, FG
CAS Number: 106-29-6
Empirical Formula (Hill Notation): C14H24O2
Molecular Weight: 224.34
EC Number: 203-381-3
MDL Number: MFCD00036538
Linear Formula: CH3CH2CH2CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2
Product Type: Chemical
| application(s) | flavors and fragrances |
| assay | ≥95% |
| bp | 151-153 °C/18 mmHg (lit.) |
| density | 0.896 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Halal | |
| Kosher | |
| natural | |
| InChI | 1S/C14H24O2/c1-5-7-14(15) |
| InChI key | ZSBOMYJPSRFZAL-JLHYYAGUSA |
| organoleptic | apple; fruity; waxy; rose; sweet |
| Quality Level | 400  |
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FDA 21 CFR 117 | |
| SMILES string | [H]C(CCC(C)=C(/[H])COC( |
| General description: | Geranyl butyrate is one of the key esters that may be contributing to the characteristic flavor of jamun fruit. It also occurs in tomato juice and tomato-based dried products. |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 100 g in glass bottle |
| Packaging: | 4 kg in poly drum |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335 |
| Precautionary statements | P261 - P271 - P304 + P340 + P312 - P403 + P233 - P405 - P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | ≥95% |
| bp | 151-153 °C/18 mmHg (lit.) |
| Density | 0.896 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2512 |
| UNSPSC | 12164502 |