Synonym: Geranyl 3-methyl butanoate; Trans-3,7-dimethyl-2,6-octadien-1-yl isovalerate; [(3E)-3,7-dimethylocta-3,6-dienyl] 3-methylbutanoate
CAS Number: 109-20-6
Empirical Formula (Hill Notation): C15H26O2
Molecular Weight: 238.37
EC Number: 203-655-2
MDL Number: MFCD00036514
Linear Formula: (CH3)2CHCH2CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2
Product Type: Chemical
| agency |
follows IFRA guidelines |
| |
meets purity specifications of JECFA |
| application(s) |
flavors and fragrances |
| assay |
≥95% |
| biological source |
synthetic |
| bp |
279 °C (lit.) |
| composition |
contains IFRA and EU 1223/2009 restricted Geraniol |
| contains |
alpha-tocopherol, synthetic as stabilizer |
| density |
0.89 g/mL at 25 °C (lit.) |
| documentation |
see Safety & Documentation for available documents |
| food allergen |
no known allergens |
| fragrance allergen |
geraniol |
| grade |
FG |
| |
Fragrance grade |
| |
Halal |
| |
Kosher |
| InChI |
1S/C15H26O2/c1-12(2)7-6-8-14(5)9-10-17-15(16)11-13(3)4/h7,9,13H,6,8,10-11H2,1-5H3/b14-9+ |
| InChI key |
SOUKTGNMIRUIQN-NTEUORMPSA-N |
| organoleptic |
apple; blueberry; green; fruity; pineapple |
| Quality Level |
300  |
| |
400 |
| refractive index |
n20/D 1.458 (lit.) |
| reg. compliance |
EU Regulation 1223/2009 |
| |
EU Regulation 1334/2008 & 178/2002 |
| |
FDA 21 CFR 172.515 |
| SMILES string |
CC(C)CC(=O)OCC=C(/C)CCC=C(C)C |
| Packaging: |
1 kg in glass bottle |
| Packaging: |
4 kg in steel drum |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95% |
| bp |
279 °C (lit.) |
| Density |
0.89 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.458 (lit.) |
| FEMA Number |
2518 |
| UNSPSC |
12164502 |
